About 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole
1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole (PubChem CID 155518831) has the molecular formula C19H13Cl2N3
and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole.
Molecular Properties
| Compound Name | 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole |
| PubChem CID | 155518831 |
| Molecular Formula | C19H13Cl2N3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole |
| SMILES | Clc1ccc(-c2ccc(Cn3nnc4ccccc43)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2N3/c20-15-9-10-16(17(21)11-15)14-7-5-13(6-8-14)12-24-19-4-2-1-3-18(19)22-23-24/h1-11H,12H2 |
| InChIKey | LGUSEIYHPBMFKA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole?
The IUPAC name of 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole (CID 155518831) is 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole.
What is the SMILES notation for 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole?
The canonical SMILES for 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole is Clc1ccc(-c2ccc(Cn3nnc4ccccc43)cc2)c(Cl)c1.
What is the InChIKey of 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole?
The InChIKey is LGUSEIYHPBMFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2N3/c20-15-9-10-16(17(21)11-15)14-7-5-13(6-8-14)12-24-19-4-2-1-3-18(19)22-23-24/h1-11H,12H2.
What are the key properties of 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole?
1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole has a molecular weight of 354.24 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(2,4-dichlorophenyl)phenyl]methyl]benzotriazole is sourced from PubChem (CID 155518831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).