C16H21BrFN7O5S — CID 155518865
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-methoxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155518865) has the molecular formula C16H21BrFN7O5S and a molecular weight of 522.36 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-methoxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-methoxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155518865 |
| Molecular Formula | C16H21BrFN7O5S |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-methoxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COCCN1CCN(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)S1(=O)=O |
| InChI | InChI=1S/C16H21BrFN7O5S/c1-29-9-8-25-7-6-24(31(25,27)28)5-4-19-15-14(22-30-23-15)16(21-26)20-11-2-3-13(18)12(17)10-11/h2-3,10,26H,4-9H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | NQGJIPSSKWDBFO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|