About 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea
1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea (PubChem CID 155518881) has the molecular formula C25H22FN3O6S
and a molecular weight of 511.53 g/mol. Its IUPAC name is 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea.
Molecular Properties
| Compound Name | 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea |
| PubChem CID | 155518881 |
| Molecular Formula | C25H22FN3O6S |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NS(=O)(=O)Cc4ccccc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C25H22FN3O6S/c1-33-23-13-18-20(14-24(23)34-2)27-11-10-21(18)35-22-9-8-17(12-19(22)26)28-25(30)29-36(31,32)15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3,(H2,28,29,30) |
| InChIKey | RXXPQWQSIOFGQU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea?
The IUPAC name of 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea (CID 155518881) is 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea.
What is the SMILES notation for 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea?
The canonical SMILES for 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea is COc1cc2nccc(Oc3ccc(NC(=O)NS(=O)(=O)Cc4ccccc4)cc3F)c2cc1OC.
What is the InChIKey of 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea?
The InChIKey is RXXPQWQSIOFGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22FN3O6S/c1-33-23-13-18-20(14-24(23)34-2)27-11-10-21(18)35-22-9-8-17(12-19(22)26)28-25(30)29-36(31,32)15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3,(H2,28,29,30).
What are the key properties of 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea?
1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea has a molecular weight of 511.53 g/mol, XLogP of 4.83, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfonyl-3-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]urea is sourced from PubChem (CID 155518881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).