About N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide
N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide (PubChem CID 155518882) has the molecular formula C17H17ClN4O
and a molecular weight of 328.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide |
| PubChem CID | 155518882 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cncc(N2CC3CC(C2)N3)c1 |
| InChI | InChI=1S/C17H17ClN4O/c18-12-1-3-13(4-2-12)21-17(23)11-5-16(8-19-7-11)22-9-14-6-15(10-22)20-14/h1-5,7-8,14-15,20H,6,9-10H2,(H,21,23) |
| InChIKey | GMZBJZZVVRFIAN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide (CID 155518882) is N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide is O=C(Nc1ccc(Cl)cc1)c1cncc(N2CC3CC(C2)N3)c1.
What is the InChIKey of N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide?
The InChIKey is GMZBJZZVVRFIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O/c18-12-1-3-13(4-2-12)21-17(23)11-5-16(8-19-7-11)22-9-14-6-15(10-22)20-14/h1-5,7-8,14-15,20H,6,9-10H2,(H,21,23).
What are the key properties of N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide?
N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide has a molecular weight of 328.80 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-5-(3,6-diazabicyclo[3.1.1]heptan-3-yl)pyridine-3-carboxamide is sourced from PubChem (CID 155518882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).