About 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride
1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride (PubChem CID 155518997) has the molecular formula C10H16ClN5S
and a molecular weight of 273.79 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride |
| PubChem CID | 155518997 |
| Molecular Formula | C10H16ClN5S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride |
| SMILES | CNc1cccnc1/C=N/NC(=S)N(C)C.Cl |
| InChI | InChI=1S/C10H15N5S.ClH/c1-11-8-5-4-6-12-9(8)7-13-14-10(16)15(2)3;/h4-7,11H,1-3H3,(H,14,16);1H/b13-7+; |
| InChIKey | HDWYPNVSPBUTCS-FTPOTTDRSA-N |
| XLogP | 1.32 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride?
The IUPAC name of 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride (CID 155518997) is 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride.
What is the SMILES notation for 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride?
The canonical SMILES for 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride is CNc1cccnc1/C=N/NC(=S)N(C)C.Cl.
What is the InChIKey of 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride?
The InChIKey is HDWYPNVSPBUTCS-FTPOTTDRSA-N. The full InChI is InChI=1S/C10H15N5S.ClH/c1-11-8-5-4-6-12-9(8)7-13-14-10(16)15(2)3;/h4-7,11H,1-3H3,(H,14,16);1H/b13-7+;.
What are the key properties of 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride?
1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride has a molecular weight of 273.79 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3-[(E)-[3-(methylamino)-2-pyridinyl]methylideneamino]thiourea;hydrochloride is sourced from PubChem (CID 155518997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).