C23H25F3N4S — CID 155519027
1-N-[(1S,2R)-2-phenylcyclopropyl]-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,4-diamine (PubChem CID 155519027) has the molecular formula C23H25F3N4S and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-N-[(1S,2R)-2-phenylcyclopropyl]-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,4-diamine.
| Compound Name | 1-N-[(1S,2R)-2-phenylcyclopropyl]-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 155519027 |
| Molecular Formula | C23H25F3N4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-N-[(1S,2R)-2-phenylcyclopropyl]-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,4-diamine |
| SMILES | FC(F)(F)Cc1cc2c(NC3CCC(N[C@H]4C[C@@H]4c4ccccc4)CC3)ncnc2s1 |
| InChI | InChI=1S/C23H25F3N4S/c24-23(25,26)12-17-10-19-21(27-13-28-22(19)31-17)30-16-8-6-15(7-9-16)29-20-11-18(20)14-4-2-1-3-5-14/h1-5,10,13,15-16,18,20,29H,6-9,11-12H2,(H,27,28,30)/t15?,16?,18-,20+/m1/s1 |
| InChIKey | GHFWKCSPLHGKTP-CCJHYTBNSA-N |
| XLogP | 5.66 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |