C32H32N6O — CID 155519031
6-methoxy-4-[(R)-(5-prop-2-enyl-1-azabicyclo[2.2.2]octan-2-yl)-(4-quinolin-2-yltriazol-1-yl)methyl]quinoline (PubChem CID 155519031) has the molecular formula C32H32N6O and a molecular weight of 516.65 g/mol. Its IUPAC name is 6-methoxy-4-[(R)-(5-prop-2-enyl-1-azabicyclo[2.2.2]octan-2-yl)-(4-quinolin-2-yltriazol-1-yl)methyl]quinoline.
| Compound Name | 6-methoxy-4-[(R)-(5-prop-2-enyl-1-azabicyclo[2.2.2]octan-2-yl)-(4-quinolin-2-yltriazol-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 155519031 |
| Molecular Formula | C32H32N6O |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 6-methoxy-4-[(R)-(5-prop-2-enyl-1-azabicyclo[2.2.2]octan-2-yl)-(4-quinolin-2-yltriazol-1-yl)methyl]quinoline |
| SMILES | C=CCC1CN2CCC1CC2[C@@H](c1ccnc2ccc(OC)cc12)n1cc(-c2ccc3ccccc3n2)nn1 |
| InChI | InChI=1S/C32H32N6O/c1-3-6-23-19-37-16-14-22(23)17-31(37)32(25-13-15-33-28-12-10-24(39-2)18-26(25)28)38-20-30(35-36-38)29-11-9-21-7-4-5-8-27(21)34-29/h3-5,7-13,15,18,20,22-23,31-32H,1,6,14,16-17,19H2,2H3/t22?,23?,31?,32-/m1/s1 |
| InChIKey | GZAXFHAMFSNDFY-DNFCSQGASA-N |
| XLogP | 5.93 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|