C25H17BrClN3 — CID 155519041
3-(4-bromophenyl)-5-(4-chlorophenyl)-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10,12,14-hexaene (PubChem CID 155519041) has the molecular formula C25H17BrClN3 and a molecular weight of 474.79 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-(4-chlorophenyl)-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10,12,14-hexaene.
| Compound Name | 3-(4-bromophenyl)-5-(4-chlorophenyl)-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10,12,14-hexaene |
|---|---|
| PubChem CID | 155519041 |
| Molecular Formula | C25H17BrClN3 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 3-(4-bromophenyl)-5-(4-chlorophenyl)-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10,12,14-hexaene |
| SMILES | Clc1ccc(-c2nc(-c3ccc(Br)cc3)c3n2CCc2c-3[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H17BrClN3/c26-17-9-5-15(6-10-17)22-24-23-20(19-3-1-2-4-21(19)28-23)13-14-30(24)25(29-22)16-7-11-18(27)12-8-16/h1-12,28H,13-14H2 |
| InChIKey | VMJFTTYISKHODM-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|