About 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one
2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 155519045) has the molecular formula C26H30N4OS
and a molecular weight of 446.62 g/mol. Its IUPAC name is 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 155519045 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCCN2CCN(Cc3ccccc3)CC2)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C26H30N4OS/c31-26-25-24(21-11-6-7-12-22(21)32-25)27-23(28-26)13-5-2-8-14-29-15-17-30(18-16-29)19-20-9-3-1-4-10-20/h1,3-4,6-7,9-12H,2,5,8,13-19H2,(H,27,28,31) |
| InChIKey | AKGAFPAMSJSPPN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (CID 155519045) is 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is O=c1[nH]c(CCCCCN2CCN(Cc3ccccc3)CC2)nc2c1sc1ccccc12.
What is the InChIKey of 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The InChIKey is AKGAFPAMSJSPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N4OS/c31-26-25-24(21-11-6-7-12-22(21)32-25)27-23(28-26)13-5-2-8-14-29-15-17-30(18-16-29)19-20-9-3-1-4-10-20/h1,3-4,6-7,9-12H,2,5,8,13-19H2,(H,27,28,31).
What are the key properties of 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one has a molecular weight of 446.62 g/mol, XLogP of 4.67, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-benzylpiperazin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 155519045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).