C20H21FN8O4S — CID 155519064
1-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea (PubChem CID 155519064) has the molecular formula C20H21FN8O4S and a molecular weight of 488.51 g/mol. Its IUPAC name is 1-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 155519064 |
| Molecular Formula | C20H21FN8O4S |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Nc2nc(Nc3ccc(F)cc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H21FN8O4S/c21-13-1-3-14(4-2-13)23-17-25-18(27-19(26-17)29-9-11-33-12-10-29)28-20(30)24-15-5-7-16(8-6-15)34(22,31)32/h1-8H,9-12H2,(H2,22,31,32)(H3,23,24,25,26,27,28,30) |
| InChIKey | NIMVSIFRQCVXMU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 164.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |