C23H21FN4OS — CID 155519145
11-benzyl-N-(4-fluoro-2-methoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 155519145) has the molecular formula C23H21FN4OS and a molecular weight of 420.51 g/mol. Its IUPAC name is 11-benzyl-N-(4-fluoro-2-methoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 11-benzyl-N-(4-fluoro-2-methoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 155519145 |
| Molecular Formula | C23H21FN4OS |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 11-benzyl-N-(4-fluoro-2-methoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | COc1cc(F)ccc1Nc1ncnc2sc3c(c12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C23H21FN4OS/c1-29-19-11-16(24)7-8-18(19)27-22-21-17-9-10-28(12-15-5-3-2-4-6-15)13-20(17)30-23(21)26-14-25-22/h2-8,11,14H,9-10,12-13H2,1H3,(H,25,26,27) |
| InChIKey | JQXWAHWMFCOUSB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |