About 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine
1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine (PubChem CID 155519232) has the molecular formula C18H12Cl2N4O4
and a molecular weight of 419.22 g/mol. Its IUPAC name is 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine |
| PubChem CID | 155519232 |
| Molecular Formula | C18H12Cl2N4O4 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccc(Cl)cc2)cc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2N4O4/c19-11-1-5-13(6-2-11)21-15-9-16(22-14-7-3-12(20)4-8-14)18(24(27)28)10-17(15)23(25)26/h1-10,21-22H |
| InChIKey | GGCQKPARLSNYBB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine?
The IUPAC name of 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine (CID 155519232) is 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine.
What is the SMILES notation for 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine?
The canonical SMILES for 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccc(Cl)cc2)cc1Nc1ccc(Cl)cc1.
What is the InChIKey of 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine?
The InChIKey is GGCQKPARLSNYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N4O4/c19-11-1-5-13(6-2-11)21-15-9-16(22-14-7-3-12(20)4-8-14)18(24(27)28)10-17(15)23(25)26/h1-10,21-22H.
What are the key properties of 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine?
1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine has a molecular weight of 419.22 g/mol, XLogP of 6.30, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(4-chlorophenyl)-4,6-dinitrobenzene-1,3-diamine is sourced from PubChem (CID 155519232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).