C20H28O3 — CID 155519462
(3S,6R,7R,9Z,11S)-6-(2-hydroxypropan-2-yl)-3,10,14-trimethyltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione (PubChem CID 155519462) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3S,6R,7R,9Z,11S)-6-(2-hydroxypropan-2-yl)-3,10,14-trimethyltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione.
| Compound Name | (3S,6R,7R,9Z,11S)-6-(2-hydroxypropan-2-yl)-3,10,14-trimethyltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione |
|---|---|
| PubChem CID | 155519462 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3S,6R,7R,9Z,11S)-6-(2-hydroxypropan-2-yl)-3,10,14-trimethyltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione |
| SMILES | CC1=C2C[C@]3(C)C(=O)C[C@@H](C(C)(C)O)[C@H]3C/C=C(/C)[C@@H]2CC1=O |
| InChI | InChI=1S/C20H28O3/c1-11-6-7-15-16(19(3,4)23)9-18(22)20(15,5)10-14-12(2)17(21)8-13(11)14/h6,13,15-16,23H,7-10H2,1-5H3/b11-6-/t13-,15+,16+,20-/m0/s1 |
| InChIKey | MXRDKYJNQZLJKG-GLXKOJNESA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|