About 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile
4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile (PubChem CID 155519514) has the molecular formula C18H17N5O2
and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile |
| PubChem CID | 155519514 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile |
| SMILES | CC1=C(CCc2nnnn2CCCC#N)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H17N5O2/c1-12-13(18(25)15-7-3-2-6-14(15)17(12)24)8-9-16-20-21-22-23(16)11-5-4-10-19/h2-3,6-7H,4-5,8-9,11H2,1H3 |
| InChIKey | XHBZUGKIGSTCGG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile?
The IUPAC name of 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile (CID 155519514) is 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile.
What is the SMILES notation for 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile?
The canonical SMILES for 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile is CC1=C(CCc2nnnn2CCCC#N)C(=O)c2ccccc2C1=O.
What is the InChIKey of 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile?
The InChIKey is XHBZUGKIGSTCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O2/c1-12-13(18(25)15-7-3-2-6-14(15)17(12)24)8-9-16-20-21-22-23(16)11-5-4-10-19/h2-3,6-7H,4-5,8-9,11H2,1H3.
What are the key properties of 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile?
4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile has a molecular weight of 335.37 g/mol, XLogP of 2.31, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)ethyl]tetrazol-1-yl]butanenitrile is sourced from PubChem (CID 155519514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).