C24H22N4O2S — CID 155519522
N-[3-[4-[[(1S)-2-hydroxy-1-phenylethyl]amino]-6-methylthieno[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide (PubChem CID 155519522) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[3-[4-[[(1S)-2-hydroxy-1-phenylethyl]amino]-6-methylthieno[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[[(1S)-2-hydroxy-1-phenylethyl]amino]-6-methylthieno[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155519522 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[3-[4-[[(1S)-2-hydroxy-1-phenylethyl]amino]-6-methylthieno[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c(C)sc3ncnc(N[C@H](CO)c4ccccc4)c23)c1 |
| InChI | InChI=1S/C24H22N4O2S/c1-3-20(30)27-18-11-7-10-17(12-18)21-15(2)31-24-22(21)23(25-14-26-24)28-19(13-29)16-8-5-4-6-9-16/h3-12,14,19,29H,1,13H2,2H3,(H,27,30)(H,25,26,28)/t19-/m1/s1 |
| InChIKey | HOBHTUUIQQNJOF-LJQANCHMSA-N |
| XLogP | 4.94 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|