C24H34O8 — CID 155519642
[(2R,3S,3aS,4R,5E,9S,10R,12E)-3a-acetyloxy-3,4,10-trihydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-9-yl] acetate (PubChem CID 155519642) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a-acetyloxy-3,4,10-trihydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-9-yl] acetate.
| Compound Name | [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a-acetyloxy-3,4,10-trihydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-9-yl] acetate |
|---|---|
| PubChem CID | 155519642 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a-acetyloxy-3,4,10-trihydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-9-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)C(=O)/C(C)=C/C2=C[C@@H](C)[C@H](O)[C@]2(OC(C)=O)[C@H](O)/C(C)=C/CC1(C)C |
| InChI | InChI=1S/C24H34O8/c1-12-8-9-23(6,7)22(31-15(4)25)19(28)18(27)13(2)10-17-11-14(3)21(30)24(17,20(12)29)32-16(5)26/h8,10-11,14,19-22,28-30H,9H2,1-7H3/b12-8+,13-10+/t14-,19+,20-,21+,22-,24-/m1/s1 |
| InChIKey | SCALLQGZXPJEJF-ZBDDMSNSSA-N |
| XLogP | 1.77 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|