C19H20F3N3O3 — CID 155519770
(3R,5S)-5-[[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155519770) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155519770 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C19H20F3N3O3/c20-19(21,22)15-3-1-2-13(7-15)17-5-4-16(28-17)11-25-24-9-12-6-14(18(26)27)10-23-8-12/h1-5,7,11-12,14,23-24H,6,8-10H2,(H,26,27)/b25-11+/t12-,14+/m0/s1 |
| InChIKey | JAEYGNGDBKODDR-GEHVOCGJSA-N |
| XLogP | 3.20 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|