C21H32O5 — CID 155519791
methyl 2-[(1R,2R,5S)-5-acetyloxy-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxycyclohex-3-en-1-yl]acetate (PubChem CID 155519791) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl 2-[(1R,2R,5S)-5-acetyloxy-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxycyclohex-3-en-1-yl]acetate.
| Compound Name | methyl 2-[(1R,2R,5S)-5-acetyloxy-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxycyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 155519791 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl 2-[(1R,2R,5S)-5-acetyloxy-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxycyclohex-3-en-1-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C/C=C(\C)CCC=C(C)C)C[C@H](OC(C)=O)C=C[C@H]1O |
| InChI | InChI=1S/C21H32O5/c1-15(2)7-6-8-16(3)11-12-21(14-20(24)25-5)13-18(26-17(4)22)9-10-19(21)23/h7,9-11,18-19,23H,6,8,12-14H2,1-5H3/b16-11+/t18-,19-,21-/m1/s1 |
| InChIKey | LOCHIJJHKAVDIR-GCJJDYHJSA-N |
| XLogP | 3.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|