C15H26O2 — CID 155519846
(1R,4S,7S,8R,11S)-2,2,4,8-tetramethyltricyclo[5.3.1.04,11]undecane-1,11-diol (PubChem CID 155519846) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,4S,7S,8R,11S)-2,2,4,8-tetramethyltricyclo[5.3.1.04,11]undecane-1,11-diol.
| Compound Name | (1R,4S,7S,8R,11S)-2,2,4,8-tetramethyltricyclo[5.3.1.04,11]undecane-1,11-diol |
|---|---|
| PubChem CID | 155519846 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,4S,7S,8R,11S)-2,2,4,8-tetramethyltricyclo[5.3.1.04,11]undecane-1,11-diol |
| SMILES | C[C@@H]1CC[C@@]2(O)C(C)(C)C[C@]3(C)CC[C@@H]1[C@]32O |
| InChI | InChI=1S/C15H26O2/c1-10-5-8-14(16)12(2,3)9-13(4)7-6-11(10)15(13,14)17/h10-11,16-17H,5-9H2,1-4H3/t10-,11+,13+,14-,15+/m1/s1 |
| InChIKey | YNXVTFPRRSPPOQ-WKZARQIDSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |