About N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine
N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 155519937) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| PubChem CID | 155519937 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | c1ccc(CNc2ccc(-c3c[nH]c4ncccc34)cn2)cc1 |
| InChI | InChI=1S/C19H16N4/c1-2-5-14(6-3-1)11-21-18-9-8-15(12-22-18)17-13-23-19-16(17)7-4-10-20-19/h1-10,12-13H,11H2,(H,20,23)(H,21,22) |
| InChIKey | DTRKEOKFLWSGTB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The IUPAC name of N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (CID 155519937) is N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
What is the SMILES notation for N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The canonical SMILES for N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine is c1ccc(CNc2ccc(-c3c[nH]c4ncccc34)cn2)cc1.
What is the InChIKey of N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The InChIKey is DTRKEOKFLWSGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4/c1-2-5-14(6-3-1)11-21-18-9-8-15(12-22-18)17-13-23-19-16(17)7-4-10-20-19/h1-10,12-13H,11H2,(H,20,23)(H,21,22).
What are the key properties of N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine has a molecular weight of 300.37 g/mol, XLogP of 4.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine is sourced from PubChem (CID 155519937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).