C33H38BrN3O4 — CID 155520046
(1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-2-(2,6-dimethoxy-4-pyridinyl)-4-(dimethylamino)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)butan-2-ol (PubChem CID 155520046) has the molecular formula C33H38BrN3O4 and a molecular weight of 620.59 g/mol. Its IUPAC name is (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-2-(2,6-dimethoxy-4-pyridinyl)-4-(dimethylamino)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)butan-2-ol.
| Compound Name | (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-2-(2,6-dimethoxy-4-pyridinyl)-4-(dimethylamino)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 155520046 |
| Molecular Formula | C33H38BrN3O4 |
| Molecular Weight | 620.59 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-2-(2,6-dimethoxy-4-pyridinyl)-4-(dimethylamino)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)butan-2-ol |
| SMILES | COc1cc([C@](O)(CCN(C)C)[C@@H](c2cc3cc(Br)ccc3nc2OC)c2cccc3c2CCCC3)cc(OC)n1 |
| InChI | InChI=1S/C33H38BrN3O4/c1-37(2)16-15-33(38,23-19-29(39-3)36-30(20-23)40-4)31(26-12-8-10-21-9-6-7-11-25(21)26)27-18-22-17-24(34)13-14-28(22)35-32(27)41-5/h8,10,12-14,17-20,31,38H,6-7,9,11,15-16H2,1-5H3/t31-,33-/m1/s1 |
| InChIKey | YEGWEZNQGSXHHQ-ZQWAWDFXSA-N |
| XLogP | 6.27 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |