C20H12ClN5OS2 — CID 155520102
1-[[3-[2-(5-chlorothiophen-2-yl)ethynyl]imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea (PubChem CID 155520102) has the molecular formula C20H12ClN5OS2 and a molecular weight of 437.94 g/mol. Its IUPAC name is 1-[[3-[2-(5-chlorothiophen-2-yl)ethynyl]imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea.
| Compound Name | 1-[[3-[2-(5-chlorothiophen-2-yl)ethynyl]imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea |
|---|---|
| PubChem CID | 155520102 |
| Molecular Formula | C20H12ClN5OS2 |
| Molecular Weight | 437.94 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 1-[[3-[2-(5-chlorothiophen-2-yl)ethynyl]imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)NCc2cnc3scc(C#Cc4ccc(Cl)s4)n23)cc1 |
| InChI | InChI=1S/C20H12ClN5OS2/c21-18-8-7-17(29-18)6-5-15-12-28-20-24-11-16(26(15)20)10-23-19(27)25-14-3-1-13(9-22)2-4-14/h1-4,7-8,11-12H,10H2,(H2,23,25,27) |
| InChIKey | APPLZWSQZGKEGP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|