About 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide
4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide (PubChem CID 155520159) has the molecular formula C17H16N2O4S
and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide |
| PubChem CID | 155520159 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC2(O)CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c18-11-13-5-7-14(8-6-13)24(21,22)19-12-17(20)9-10-23-16-4-2-1-3-15(16)17/h1-8,19-20H,9-10,12H2 |
| InChIKey | OBUUPYNHCWEKGL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The IUPAC name of 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide (CID 155520159) is 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The canonical SMILES for 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide is N#Cc1ccc(S(=O)(=O)NCC2(O)CCOc3ccccc32)cc1.
What is the InChIKey of 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The InChIKey is OBUUPYNHCWEKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4S/c18-11-13-5-7-14(8-6-13)24(21,22)19-12-17(20)9-10-23-16-4-2-1-3-15(16)17/h1-8,19-20H,9-10,12H2.
What are the key properties of 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide has a molecular weight of 344.39 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 155520159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).