C23H27N3O4S — CID 155520244
4-[2-(2,5-dimethoxyphenyl)ethyl]-11-(2-methylpropanoyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 155520244) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-(2-methylpropanoyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-(2-methylpropanoyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 155520244 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-(2-methylpropanoyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COc1ccc(OC)c(CCn2cnc3sc4c(c3c2=O)CCN(C(=O)C(C)C)C4)c1 |
| InChI | InChI=1S/C23H27N3O4S/c1-14(2)22(27)25-10-8-17-19(12-25)31-21-20(17)23(28)26(13-24-21)9-7-15-11-16(29-3)5-6-18(15)30-4/h5-6,11,13-14H,7-10,12H2,1-4H3 |
| InChIKey | LSDMZBDLXHEDCE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |