C20H28 — CID 155520255
(3aR,6aS,11bS,11cR)-3,3,6a-trimethyl-2,3a,4,5,6,7,11b,11c-octahydro-1H-benzo[a]phenalene (PubChem CID 155520255) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is (3aR,6aS,11bS,11cR)-3,3,6a-trimethyl-2,3a,4,5,6,7,11b,11c-octahydro-1H-benzo[a]phenalene.
| Compound Name | (3aR,6aS,11bS,11cR)-3,3,6a-trimethyl-2,3a,4,5,6,7,11b,11c-octahydro-1H-benzo[a]phenalene |
|---|---|
| PubChem CID | 155520255 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (3aR,6aS,11bS,11cR)-3,3,6a-trimethyl-2,3a,4,5,6,7,11b,11c-octahydro-1H-benzo[a]phenalene |
| SMILES | CC1(C)CC[C@@H]2c3ccccc3C[C@]3(C)CCC[C@@H]1[C@H]23 |
| InChI | InChI=1S/C20H28/c1-19(2)12-10-16-15-8-5-4-7-14(15)13-20(3)11-6-9-17(19)18(16)20/h4-5,7-8,16-18H,6,9-13H2,1-3H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | PRICXUFYDCXKRB-XSYGEPLQSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |