C32H41NO6S — CID 155520265
[(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-17-[(2E)-2-(4-methylphenyl)sulfonylimino-2-propoxyethyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155520265) has the molecular formula C32H41NO6S and a molecular weight of 567.75 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-17-[(2E)-2-(4-methylphenyl)sulfonylimino-2-propoxyethyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-17-[(2E)-2-(4-methylphenyl)sulfonylimino-2-propoxyethyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155520265 |
| Molecular Formula | C32H41NO6S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-17-[(2E)-2-(4-methylphenyl)sulfonylimino-2-propoxyethyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCCO/C(C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OC(C)=O)ccc4[C@H]3CC[C@@]21C)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H41NO6S/c1-5-18-38-30(33-40(36,37)25-10-6-21(2)7-11-25)20-32(35)17-15-29-28-12-8-23-19-24(39-22(3)34)9-13-26(23)27(28)14-16-31(29,32)4/h6-7,9-11,13,19,27-29,35H,5,8,12,14-18,20H2,1-4H3/b33-30+/t27-,28-,29+,31+,32-/m1/s1 |
| InChIKey | ZDLNKTMMCGLMSW-VUEYLNPHSA-N |
| XLogP | 6.11 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|