About 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide
6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 155520507) has the molecular formula C11H8O4S
and a molecular weight of 236.25 g/mol. Its IUPAC name is 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide.
Molecular Properties
| Compound Name | 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide |
| PubChem CID | 155520507 |
| Molecular Formula | C11H8O4S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | C#CCOc1ccc2c(c1)C=CS(=O)(=O)O2 |
| InChI | InChI=1S/C11H8O4S/c1-2-6-14-10-3-4-11-9(8-10)5-7-16(12,13)15-11/h1,3-5,7-8H,6H2 |
| InChIKey | GUSAFFVHXSQLGX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide?
The IUPAC name of 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide (CID 155520507) is 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide.
What is the SMILES notation for 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide?
The canonical SMILES for 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide is C#CCOc1ccc2c(c1)C=CS(=O)(=O)O2.
What is the InChIKey of 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide?
The InChIKey is GUSAFFVHXSQLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O4S/c1-2-6-14-10-3-4-11-9(8-10)5-7-16(12,13)15-11/h1,3-5,7-8H,6H2.
What are the key properties of 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide?
6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide has a molecular weight of 236.25 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-ynoxy-1,2λ6-benzoxathiine 2,2-dioxide is sourced from PubChem (CID 155520507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).