About 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one
4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one (PubChem CID 155520529) has the molecular formula C21H21NO5
and a molecular weight of 367.40 g/mol. Its IUPAC name is 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one |
| PubChem CID | 155520529 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3OC)[nH]c(=O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H21NO5/c1-24-14-5-7-16(19(11-14)26-3)13-9-18(22-21(23)10-13)17-8-6-15(25-2)12-20(17)27-4/h5-12H,1-4H3,(H,22,23) |
| InChIKey | AABVQDHPJSLEBD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The IUPAC name of 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one (CID 155520529) is 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one.
What is the SMILES notation for 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The canonical SMILES for 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one is COc1ccc(-c2cc(-c3ccc(OC)cc3OC)[nH]c(=O)c2)c(OC)c1.
What is the InChIKey of 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The InChIKey is AABVQDHPJSLEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5/c1-24-14-5-7-16(19(11-14)26-3)13-9-18(22-21(23)10-13)17-8-6-15(25-2)12-20(17)27-4/h5-12H,1-4H3,(H,22,23).
What are the key properties of 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one has a molecular weight of 367.40 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(2,4-dimethoxyphenyl)-1H-pyridin-2-one is sourced from PubChem (CID 155520529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).