C20H19N3O4 — CID 155520593
3-(1H-indol-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 155520593) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1H-indol-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155520593 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2nc(Cc3c[nH]c4ccccc34)no2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N3O4/c1-24-16-8-12(9-17(25-2)19(16)26-3)20-22-18(23-27-20)10-13-11-21-15-7-5-4-6-14(13)15/h4-9,11,21H,10H2,1-3H3 |
| InChIKey | GJOBPZRRLHPSJD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |