C16H13ClN2O2 — CID 155520678
5-chloro-N-[2-(hydroxymethyl)phenyl]-1H-indole-3-carboxamide (PubChem CID 155520678) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 5-chloro-N-[2-(hydroxymethyl)phenyl]-1H-indole-3-carboxamide.
| Compound Name | 5-chloro-N-[2-(hydroxymethyl)phenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 155520678 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-chloro-N-[2-(hydroxymethyl)phenyl]-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1CO)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H13ClN2O2/c17-11-5-6-15-12(7-11)13(8-18-15)16(21)19-14-4-2-1-3-10(14)9-20/h1-8,18,20H,9H2,(H,19,21) |
| InChIKey | ACDUZZHOSPGOKE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |