C17H26O7 — CID 155520779
[(2S,3S,4R)-2-[(Z,3S)-3-acetyloxyhept-1-enyl]-4-methoxy-6-oxooxan-3-yl] acetate (PubChem CID 155520779) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2S,3S,4R)-2-[(Z,3S)-3-acetyloxyhept-1-enyl]-4-methoxy-6-oxooxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R)-2-[(Z,3S)-3-acetyloxyhept-1-enyl]-4-methoxy-6-oxooxan-3-yl] acetate |
|---|---|
| PubChem CID | 155520779 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(2S,3S,4R)-2-[(Z,3S)-3-acetyloxyhept-1-enyl]-4-methoxy-6-oxooxan-3-yl] acetate |
| SMILES | CCCC[C@@H](/C=C\[C@@H]1OC(=O)C[C@@H](OC)[C@@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H26O7/c1-5-6-7-13(22-11(2)18)8-9-14-17(23-12(3)19)15(21-4)10-16(20)24-14/h8-9,13-15,17H,5-7,10H2,1-4H3/b9-8-/t13-,14-,15+,17+/m0/s1 |
| InChIKey | ZRVHCSWBLLHRIR-UQJHPLPRSA-N |
| XLogP | 1.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|