About 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine
3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine (PubChem CID 155520979) has the molecular formula C18H20Cl2N2O
and a molecular weight of 351.28 g/mol. Its IUPAC name is 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine.
Molecular Properties
| Compound Name | 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine |
| PubChem CID | 155520979 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine |
| SMILES | Clc1ccc(C[C@]2(COc3cccnc3)CCCNC2)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c19-16-5-4-14(9-17(16)20)10-18(6-2-8-22-12-18)13-23-15-3-1-7-21-11-15/h1,3-5,7,9,11,22H,2,6,8,10,12-13H2/t18-/m1/s1 |
| InChIKey | GDWGKXWHTRSAQZ-GOSISDBHSA-N |
| XLogP | 4.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine?
The IUPAC name of 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine (CID 155520979) is 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine.
What is the SMILES notation for 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine?
The canonical SMILES for 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine is Clc1ccc(C[C@]2(COc3cccnc3)CCCNC2)cc1Cl.
What is the InChIKey of 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine?
The InChIKey is GDWGKXWHTRSAQZ-GOSISDBHSA-N. The full InChI is InChI=1S/C18H20Cl2N2O/c19-16-5-4-14(9-17(16)20)10-18(6-2-8-22-12-18)13-23-15-3-1-7-21-11-15/h1,3-5,7,9,11,22H,2,6,8,10,12-13H2/t18-/m1/s1.
What are the key properties of 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine?
3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine has a molecular weight of 351.28 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R)-3-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methoxy]pyridine is sourced from PubChem (CID 155520979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).