C24H28F9N3O3 — CID 155521008
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 155521008) has the molecular formula C24H28F9N3O3 and a molecular weight of 577.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155521008 |
| Molecular Formula | C24H28F9N3O3 |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(C(F)(F)F)cc2N2CCC3(CCOCC3)C2)CC1 |
| InChI | InChI=1S/C24H28F9N3O3/c25-22(26,27)17-2-1-16(18(13-17)36-6-3-21(15-36)4-11-38-12-5-21)14-34-7-9-35(10-8-34)20(37)39-19(23(28,29)30)24(31,32)33/h1-2,13,19H,3-12,14-15H2 |
| InChIKey | OOOQRTKEXJOOQK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |