C25H21ClN2O3 — CID 155521045
[6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone (PubChem CID 155521045) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is [6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155521045 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-31-19-4-2-3-16(13-19)25(30)28-12-11-20-21-14-17(26)7-10-22(21)27-23(20)24(28)15-5-8-18(29)9-6-15/h2-10,13-14,24,27,29H,11-12H2,1H3 |
| InChIKey | QYXBIUZOIIUZTE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|