C14H18O4 — CID 155521064
(3S,3aS,5aR,6R,9bR)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 155521064) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (3S,3aS,5aR,6R,9bR)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aR,6R,9bR)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 155521064 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3S,3aS,5aR,6R,9bR)-6-hydroxy-3,5a-dimethyl-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2C3=CC(=O)C[C@@H](O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C14H18O4/c1-7-9-3-4-14(2)10(12(9)18-13(7)17)5-8(15)6-11(14)16/h5,7,9,11-12,16H,3-4,6H2,1-2H3/t7-,9-,11+,12+,14+/m0/s1 |
| InChIKey | VPRQMRXRWUYDQB-IXPLJYKUSA-N |
| XLogP | 1.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |