C24H28O3 — CID 155521128
(1R,9R,12S,13R)-9-methyl-3-(2-phenylethyl)-12-prop-1-en-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,13-diol (PubChem CID 155521128) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1R,9R,12S,13R)-9-methyl-3-(2-phenylethyl)-12-prop-1-en-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,13-diol.
| Compound Name | (1R,9R,12S,13R)-9-methyl-3-(2-phenylethyl)-12-prop-1-en-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,13-diol |
|---|---|
| PubChem CID | 155521128 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (1R,9R,12S,13R)-9-methyl-3-(2-phenylethyl)-12-prop-1-en-2-yl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,13-diol |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)Oc3cc(O)cc(CCc4ccccc4)c3[C@@H]1[C@H]2O |
| InChI | InChI=1S/C24H28O3/c1-15(2)19-11-12-24(3)23(26)22(19)21-17(13-18(25)14-20(21)27-24)10-9-16-7-5-4-6-8-16/h4-8,13-14,19,22-23,25-26H,1,9-12H2,2-3H3/t19-,22-,23-,24-/m1/s1 |
| InChIKey | WPFDHNWPZAVYAK-OTUUDDROSA-N |
| XLogP | 4.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|