About 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide
2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide (PubChem CID 155521214) has the molecular formula C16H19ClF4N2O
and a molecular weight of 366.79 g/mol. Its IUPAC name is 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 155521214 |
| Molecular Formula | C16H19ClF4N2O |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)N1CC[C@@H](NC(=O)c2ccc(C(F)(F)F)cc2Cl)[C@@H](F)C1 |
| InChI | InChI=1S/C16H19ClF4N2O/c1-9(2)23-6-5-14(13(18)8-23)22-15(24)11-4-3-10(7-12(11)17)16(19,20)21/h3-4,7,9,13-14H,5-6,8H2,1-2H3,(H,22,24)/t13-,14+/m0/s1 |
| InChIKey | VNYMKPMXOYCTFQ-UONOGXRCSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide?
The IUPAC name of 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide (CID 155521214) is 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide is CC(C)N1CC[C@@H](NC(=O)c2ccc(C(F)(F)F)cc2Cl)[C@@H](F)C1.
What is the InChIKey of 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide?
The InChIKey is VNYMKPMXOYCTFQ-UONOGXRCSA-N. The full InChI is InChI=1S/C16H19ClF4N2O/c1-9(2)23-6-5-14(13(18)8-23)22-15(24)11-4-3-10(7-12(11)17)16(19,20)21/h3-4,7,9,13-14H,5-6,8H2,1-2H3,(H,22,24)/t13-,14+/m0/s1.
What are the key properties of 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide?
2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide has a molecular weight of 366.79 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(3S,4R)-3-fluoro-1-propan-2-ylpiperidin-4-yl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 155521214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).