C20H27NO — CID 155521250
(6R,9R)-9-methyl-6-[(2S)-6-methylhept-5-en-2-yl]-6,7,8,9-tetrahydrobenzo[g][1,3]benzoxazole (PubChem CID 155521250) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (6R,9R)-9-methyl-6-[(2S)-6-methylhept-5-en-2-yl]-6,7,8,9-tetrahydrobenzo[g][1,3]benzoxazole.
| Compound Name | (6R,9R)-9-methyl-6-[(2S)-6-methylhept-5-en-2-yl]-6,7,8,9-tetrahydrobenzo[g][1,3]benzoxazole |
|---|---|
| PubChem CID | 155521250 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (6R,9R)-9-methyl-6-[(2S)-6-methylhept-5-en-2-yl]-6,7,8,9-tetrahydrobenzo[g][1,3]benzoxazole |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1CC[C@@H](C)c2c1ccc1ncoc21 |
| InChI | InChI=1S/C20H27NO/c1-13(2)6-5-7-14(3)16-9-8-15(4)19-17(16)10-11-18-20(19)22-12-21-18/h6,10-12,14-16H,5,7-9H2,1-4H3/t14-,15+,16+/m0/s1 |
| InChIKey | BVISKKPIEVKNMK-ARFHVFGLSA-N |
| XLogP | 6.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|