C21H28O5 — CID 155521260
(1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-11-methyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione (PubChem CID 155521260) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-11-methyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione.
| Compound Name | (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-11-methyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
|---|---|
| PubChem CID | 155521260 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-11-methyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
| SMILES | C/C1=C/C=C/C(=O)O[C@H](CO)C/C=C/[C@@H]2CCC[C@H](C/C=C/C(=O)C1)O2 |
| InChI | InChI=1S/C21H28O5/c1-16-6-2-13-21(24)26-20(15-22)12-5-11-19-10-4-9-18(25-19)8-3-7-17(23)14-16/h2-3,5-7,11,13,18-20,22H,4,8-10,12,14-15H2,1H3/b7-3+,11-5+,13-2+,16-6-/t18-,19-,20-/m0/s1 |
| InChIKey | OYNYFOHGKUIEPJ-YIOXLTTFSA-N |
| XLogP | 3.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|