C18H28O3 — CID 155521284
(1S,4S,5S,9S)-1-cyclohexyl-9-hydroxy-8-methylspiro[4.5]dec-7-ene-4-carboxylic acid (PubChem CID 155521284) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1S,4S,5S,9S)-1-cyclohexyl-9-hydroxy-8-methylspiro[4.5]dec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4S,5S,9S)-1-cyclohexyl-9-hydroxy-8-methylspiro[4.5]dec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 155521284 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (1S,4S,5S,9S)-1-cyclohexyl-9-hydroxy-8-methylspiro[4.5]dec-7-ene-4-carboxylic acid |
| SMILES | CC1=CC[C@@]2(C[C@@H]1O)[C@@H](C(=O)O)CC[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C18H28O3/c1-12-9-10-18(11-16(12)19)14(7-8-15(18)17(20)21)13-5-3-2-4-6-13/h9,13-16,19H,2-8,10-11H2,1H3,(H,20,21)/t14-,15+,16-,18-/m0/s1 |
| InChIKey | ZEQATYGPOXRDTP-DFGXFYAUSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|