C32H52O5 — CID 155521423
[(3R,4S,6R)-2,4-dihydroxy-2-methyl-6-[(5R,8S,9S,10R,14R)-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl] acetate (PubChem CID 155521423) has the molecular formula C32H52O5 and a molecular weight of 516.76 g/mol. Its IUPAC name is [(3R,4S,6R)-2,4-dihydroxy-2-methyl-6-[(5R,8S,9S,10R,14R)-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl] acetate.
| Compound Name | [(3R,4S,6R)-2,4-dihydroxy-2-methyl-6-[(5R,8S,9S,10R,14R)-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 155521423 |
| Molecular Formula | C32H52O5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | [(3R,4S,6R)-2,4-dihydroxy-2-methyl-6-[(5R,8S,9S,10R,14R)-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@@H](O)C[C@@H](C)C1=C2CC[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1)C(C)(C)O |
| InChI | InChI=1S/C32H52O5/c1-19(18-23(34)27(29(5,6)36)37-20(2)33)21-12-16-31(8)22(21)10-11-25-30(7)15-14-26(35)28(3,4)24(30)13-17-32(25,31)9/h19,23-25,27,34,36H,10-18H2,1-9H3/t19-,23+,24+,25+,27-,30+,31+,32+/m1/s1 |
| InChIKey | YXPPAEOSVBKNSF-PVDPLZRQSA-N |
| XLogP | 6.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|