C26H29ClFN6O2 — CID 155521505
CID 155521505 (PubChem CID 155521505) has the molecular formula C26H29ClFN6O2 and a molecular weight of 512.01 g/mol.
| Compound Name | CID 155521505 |
|---|---|
| PubChem CID | 155521505 |
| Molecular Formula | C26H29ClFN6O2 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3ncc(F)c(Nc4ccccc4Cl)n3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C26H29ClFN6O2/c1-25(2)13-18(14-26(3,4)34(25)36)30-23(35)16-9-11-17(12-10-16)31-24-29-15-20(28)22(33-24)32-21-8-6-5-7-19(21)27/h5-12,15,18H,13-14H2,1-4H3,(H,30,35)(H2,29,31,32,33) |
| InChIKey | SPWUNHDCOAYNOQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |