About [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride
[(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 155521591) has the molecular formula C18H28ClNO2
and a molecular weight of 325.88 g/mol. Its IUPAC name is [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride |
| PubChem CID | 155521591 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | CCCC/C=C/c1ccc(CO[C@@H]2CN[C@@H](CO)C2)cc1.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-2-3-4-5-6-15-7-9-16(10-8-15)14-21-18-11-17(13-20)19-12-18;/h5-10,17-20H,2-4,11-14H2,1H3;1H/b6-5+;/t17-,18+;/m1./s1 |
| InChIKey | QHWBHCMKLSERMR-HCIASGPUSA-N |
| XLogP | 3.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The IUPAC name of [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride (CID 155521591) is [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride is CCCC/C=C/c1ccc(CO[C@@H]2CN[C@@H](CO)C2)cc1.Cl.
What is the InChIKey of [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The InChIKey is QHWBHCMKLSERMR-HCIASGPUSA-N. The full InChI is InChI=1S/C18H27NO2.ClH/c1-2-3-4-5-6-15-7-9-16(10-8-15)14-21-18-11-17(13-20)19-12-18;/h5-10,17-20H,2-4,11-14H2,1H3;1H/b6-5+;/t17-,18+;/m1./s1.
What are the key properties of [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
[(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride has a molecular weight of 325.88 g/mol, XLogP of 3.55, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-[[4-[(E)-hex-1-enyl]phenyl]methoxy]pyrrolidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 155521591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).