C35H46N2O2 — CID 155521705
10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine (PubChem CID 155521705) has the molecular formula C35H46N2O2 and a molecular weight of 526.77 g/mol. Its IUPAC name is 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine.
| Compound Name | 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine |
|---|---|
| PubChem CID | 155521705 |
| Molecular Formula | C35H46N2O2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C35H46N2O2/c1-2-3-4-5-6-7-14-28-19-21-29(22-20-28)30-23-24-36-31(30)27-38-26-13-12-25-37-32-15-8-10-17-34(32)39-35-18-11-9-16-33(35)37/h8-11,15-22,30-31,36H,2-7,12-14,23-27H2,1H3/t30-,31-/m1/s1 |
| InChIKey | NFPYDFXOCSLKJT-FIRIVFDPSA-N |
| XLogP | 8.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|