About 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine
10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine (PubChem CID 155521705) has the molecular formula C35H46N2O2
and a molecular weight of 526.77 g/mol. Its IUPAC name is 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine |
| PubChem CID | 155521705 |
| Molecular Formula | C35H46N2O2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C35H46N2O2/c1-2-3-4-5-6-7-14-28-19-21-29(22-20-28)30-23-24-36-31(30)27-38-26-13-12-25-37-32-15-8-10-17-34(32)39-35-18-11-9-16-33(35)37/h8-11,15-22,30-31,36H,2-7,12-14,23-27H2,1H3/t30-,31-/m1/s1 |
| InChIKey | NFPYDFXOCSLKJT-FIRIVFDPSA-N |
| XLogP | 8.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine?
The IUPAC name of 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine (CID 155521705) is 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine.
What is the SMILES notation for 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine?
The canonical SMILES for 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine is CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCN2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine?
The InChIKey is NFPYDFXOCSLKJT-FIRIVFDPSA-N. The full InChI is InChI=1S/C35H46N2O2/c1-2-3-4-5-6-7-14-28-19-21-29(22-20-28)30-23-24-36-31(30)27-38-26-13-12-25-37-32-15-8-10-17-34(32)39-35-18-11-9-16-33(35)37/h8-11,15-22,30-31,36H,2-7,12-14,23-27H2,1H3/t30-,31-/m1/s1.
What are the key properties of 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine?
10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine has a molecular weight of 526.77 g/mol, XLogP of 8.78, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]butyl]phenoxazine is sourced from PubChem (CID 155521705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).