C22H25N3O4S — CID 155521709
4-[2-(2,5-dimethoxyphenyl)ethyl]-11-propanoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 155521709) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-propanoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-propanoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 155521709 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[2-(2,5-dimethoxyphenyl)ethyl]-11-propanoyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CCC(=O)N1CCc2c(sc3ncn(CCc4cc(OC)ccc4OC)c(=O)c23)C1 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-19(26)24-10-8-16-18(12-24)30-21-20(16)22(27)25(13-23-21)9-7-14-11-15(28-2)5-6-17(14)29-3/h5-6,11,13H,4,7-10,12H2,1-3H3 |
| InChIKey | QOHHZEULBRJCHF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |