C19H23FN8O2 — CID 155521718
N-[(1R,2R)-2-fluoro-4-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]cyclopentyl]prop-2-enamide (PubChem CID 155521718) has the molecular formula C19H23FN8O2 and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[(1R,2R)-2-fluoro-4-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]cyclopentyl]prop-2-enamide.
| Compound Name | N-[(1R,2R)-2-fluoro-4-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 155521718 |
| Molecular Formula | C19H23FN8O2 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(1R,2R)-2-fluoro-4-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CC(c2nc(Nc3cn(C)nc3OC)c3ncn(C)c3n2)C[C@H]1F |
| InChI | InChI=1S/C19H23FN8O2/c1-5-14(29)22-12-7-10(6-11(12)20)16-24-17(15-18(25-16)27(2)9-21-15)23-13-8-28(3)26-19(13)30-4/h5,8-12H,1,6-7H2,2-4H3,(H,22,29)(H,23,24,25)/t10?,11-,12-/m1/s1 |
| InChIKey | YQTDEGYGQASMEP-PQDIPPBSSA-N |
| XLogP | 1.74 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|