About 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol
4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol (PubChem CID 155521759) has the molecular formula C18H11F2N3OS
and a molecular weight of 355.37 g/mol. Its IUPAC name is 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol |
| PubChem CID | 155521759 |
| Molecular Formula | C18H11F2N3OS |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol |
| SMILES | Nc1ncc(-c2ccc3ncsc3c2)cc1-c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C18H11F2N3OS/c19-13-4-10(5-14(20)17(13)24)12-3-11(7-22-18(12)21)9-1-2-15-16(6-9)25-8-23-15/h1-8,24H,(H2,21,22) |
| InChIKey | QUGCQIPMQMLYFW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol?
The IUPAC name of 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol (CID 155521759) is 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol.
What is the SMILES notation for 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol?
The canonical SMILES for 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol is Nc1ncc(-c2ccc3ncsc3c2)cc1-c1cc(F)c(O)c(F)c1.
What is the InChIKey of 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol?
The InChIKey is QUGCQIPMQMLYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F2N3OS/c19-13-4-10(5-14(20)17(13)24)12-3-11(7-22-18(12)21)9-1-2-15-16(6-9)25-8-23-15/h1-8,24H,(H2,21,22).
What are the key properties of 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol?
4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol has a molecular weight of 355.37 g/mol, XLogP of 4.59, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-5-(1,3-benzothiazol-6-yl)-3-pyridinyl]-2,6-difluorophenol is sourced from PubChem (CID 155521759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).