About (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide
(E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide (PubChem CID 155521853) has the molecular formula C16H20FNO2
and a molecular weight of 277.34 g/mol. Its IUPAC name is (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide |
| PubChem CID | 155521853 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide |
| SMILES | CCCN(CCC)C(=O)/C=C/C(=O)c1ccccc1F |
| InChI | InChI=1S/C16H20FNO2/c1-3-11-18(12-4-2)16(20)10-9-15(19)13-7-5-6-8-14(13)17/h5-10H,3-4,11-12H2,1-2H3/b10-9+ |
| InChIKey | GRLOWGHIGVOMJS-MDZDMXLPSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide?
The IUPAC name of (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide (CID 155521853) is (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide.
What is the SMILES notation for (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide?
The canonical SMILES for (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide is CCCN(CCC)C(=O)/C=C/C(=O)c1ccccc1F.
What is the InChIKey of (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide?
The InChIKey is GRLOWGHIGVOMJS-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H20FNO2/c1-3-11-18(12-4-2)16(20)10-9-15(19)13-7-5-6-8-14(13)17/h5-10H,3-4,11-12H2,1-2H3/b10-9+.
What are the key properties of (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide?
(E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide has a molecular weight of 277.34 g/mol, XLogP of 3.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2-fluorophenyl)-4-oxo-N,N-dipropylbut-2-enamide is sourced from PubChem (CID 155521853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).