C20H22N8O4S — CID 155521930
1-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-3-(4-sulfamoylphenyl)urea (PubChem CID 155521930) has the molecular formula C20H22N8O4S and a molecular weight of 470.52 g/mol. Its IUPAC name is 1-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 155521930 |
| Molecular Formula | C20H22N8O4S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H22N8O4S/c21-33(30,31)16-8-6-15(7-9-16)23-20(29)27-18-24-17(22-14-4-2-1-3-5-14)25-19(26-18)28-10-12-32-13-11-28/h1-9H,10-13H2,(H2,21,30,31)(H3,22,23,24,25,26,27,29) |
| InChIKey | ZIUYXSVLMAPJBA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 164.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |