C20H23NO6S2 — CID 155522021
5-[2-(2-methylphenyl)ethynyl]-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]thiophene-2-sulfonamide (PubChem CID 155522021) has the molecular formula C20H23NO6S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[2-(2-methylphenyl)ethynyl]-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-[2-(2-methylphenyl)ethynyl]-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 155522021 |
| Molecular Formula | C20H23NO6S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 5-[2-(2-methylphenyl)ethynyl]-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccccc1C#Cc1ccc(S(=O)(=O)NC[C@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)s1 |
| InChI | InChI=1S/C20H23NO6S2/c1-12-5-3-4-6-14(12)7-8-15-9-10-17(28-15)29(25,26)21-11-16-19(23)20(24)18(22)13(2)27-16/h3-6,9-10,13,16,18-24H,11H2,1-2H3/t13-,16+,18+,19+,20+/m0/s1 |
| InChIKey | SMERLNWZQNOFHL-XXLQSDOLSA-N |
| XLogP | 0.60 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|